Products 2221-96-7
CAS 2221-96-7 is the registry number for Dihydroabietic Acid (Technical Grade). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(1R,4aR,4bS,7R,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,9,10,10a-decahydrophenanthrene-1-carboxylic acid (CAS 2221-96-7) is a chemical compound with the molecular formula C20H32O2 and a molecular weight of 304.5 g/mol. IUPAC name: (1R,4aR,4bS,7R,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,9,10,10a-decahydrophenanthrene-1-carboxylic acid. InChIKey: BTAURFWABMSODR-TWRRNRRFSA-N.
| Molecular formula | C20H32O2 |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | (1R,4aR,4bS,7R,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,9,10,10a-decahydrophenanthrene-1-carboxylic acid |
| InChIKey | BTAURFWABMSODR-TWRRNRRFSA-N |
| SMILES | CC(C)[C@H]1CC[C@H]2C(=C1)CC[C@@H]3[C@@]2(CCC[C@@]3(C)C(=O)O)C |
Computed by PubChem (NCBI)