Products 2221025-25-6
CAS 2221025-25-6 is the registry number for 8-Amino-1,4-dioxo-1,2,3,4-tetrahydrophthalazine-6-carboxylic Acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-amino-1,4-dioxo-2,3-dihydrophthalazine-6-carboxylic acid (CAS 2221025-25-6) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: 8-amino-1,4-dioxo-2,3-dihydrophthalazine-6-carboxylic acid. InChIKey: HDGQFQFBQZMJHS-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 8-amino-1,4-dioxo-2,3-dihydrophthalazine-6-carboxylic acid |
| InChIKey | HDGQFQFBQZMJHS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)NNC2=O)N)C(=O)O |
Computed by PubChem (NCBI)