CAS 2222120-27-4 is the registry number for Thalidomide-piperazine-tert-butyl formate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazine-1-carboxylate (CAS 2222120-27-4) is a chemical compound with the molecular formula C22H28N4O5 and a molecular weight of 428.5 g/mol. IUPAC name: tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazine-1-carboxylate. InChIKey: DANIYVQIRXOIKI-UHFFFAOYSA-N.
| Molecular formula | C22H28N4O5 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazine-1-carboxylate |
| InChIKey | DANIYVQIRXOIKI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC3=C(C=C2)C(=O)N(C3)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)