CAS 80189-44-2 appears in our catalog under these names: 5-Hydroxy-1,4-bis((2-((2-hydroxyethyl)amino)ethyl)amino)anthracene-9,10-dione, 98%, Mitoxantrone Impurity 2(Mitoxantrone EP Impurity B), Mitoxantrone EP Impurity B, 1-Deshydroxy Mitoxantrone, Mitoxantrone Impurity B. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg.
5-hydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione (CAS 80189-44-2) is a chemical compound with the molecular formula C22H28N4O5 and a molecular weight of 428.5 g/mol. IUPAC name: 5-hydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione. InChIKey: KWAZOPYMFGJFGI-UHFFFAOYSA-N.
| Molecular formula | C22H28N4O5 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 5-hydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| InChIKey | KWAZOPYMFGJFGI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C=CC(=C3C2=O)NCCNCCO)NCCNCCO |
Computed by PubChem (NCBI)