CAS 81919-14-4 appears in our catalog under these names: Bendazac L-lysine, 97%, Bendazac L-Lysine, Bendazac L-lysine/ 99.91% (existing batch purity), Bendazac L–Lysine, Bendazac L-lysine salt, 95%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 200mg, 500mg, 10mM (in 1ml water).
2-(1-benzylindazol-3-yl)oxyacetic acid;(2S)-2,6-diaminohexanoic acid (CAS 81919-14-4) is a chemical compound with the molecular formula C22H28N4O5 and a molecular weight of 428.5 g/mol. IUPAC name: 2-(1-benzylindazol-3-yl)oxyacetic acid;(2S)-2,6-diaminohexanoic acid. InChIKey: OCOCFNMFLNFNIA-ZSCHJXSPSA-N.
| Molecular formula | C22H28N4O5 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 2-(1-benzylindazol-3-yl)oxyacetic acid;(2S)-2,6-diaminohexanoic acid |
| InChIKey | OCOCFNMFLNFNIA-ZSCHJXSPSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=N2)OCC(=O)O.C(CCN)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)