CAS 2222683-66-9 appears in our catalog under these names: tert-Butyl (S)-(3-methylpyrrolidin-3-yl)carbamate hydrochloride, 97%, tert-Butyl (S)-(3-methylpyrrolidin-3-yl)carbamate hydrochloride, 95%, 95%, tert-Butyl (S)-(3-methylpyrrolidin-3-yl)carbamate hydrochloride, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g.
Tert-butyl N-[(3S)-3-methylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2222683-66-9) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3S)-3-methylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: WZMVQVILSXAFCT-PPHPATTJSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3S)-3-methylpyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | WZMVQVILSXAFCT-PPHPATTJSA-N |
| SMILES | C[C@@]1(CCNC1)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)