Products 2223048-48-2
CAS 2223048-48-2 is the registry number for 5-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one (CAS 2223048-48-2) is a chemical compound with the molecular formula C11H15BFNO3 and a molecular weight of 239.05 g/mol. IUPAC name: 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one. InChIKey: FYVCTSSLHDJLPZ-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO3 |
|---|---|
| Molecular weight | 239.05 g/mol |
| IUPAC name | 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one |
| InChIKey | FYVCTSSLHDJLPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=O)NC=C2F |
Computed by PubChem (NCBI)