Products 2223055-88-5
CAS 2223055-88-5 is the registry number for 3-Methyl-1-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1H-pyrazole, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
3-methyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole (CAS 2223055-88-5) is a chemical compound with the molecular formula C16H21BN2O2 and a molecular weight of 284.2 g/mol. IUPAC name: 3-methyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole. InChIKey: UAEOZTYDWXVABX-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O2 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 3-methyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
| InChIKey | UAEOZTYDWXVABX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N3C=CC(=N3)C |
Computed by PubChem (NCBI)