CAS 22233-82-5 is the registry number for (E)-1-(2,6-Dihydroxyphenyl)ethanone oxime, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzene-1,3-diol (CAS 22233-82-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzene-1,3-diol. InChIKey: SIQUZFBZMJKFMN-WEVVVXLNSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzene-1,3-diol |
| InChIKey | SIQUZFBZMJKFMN-WEVVVXLNSA-N |
| SMILES | C/C(=N\O)/C1=C(C=CC=C1O)O |
Computed by PubChem (NCBI)