CAS 2224-77-3 is the registry number for 3-(4-Chlorophenyl)-1-isoindolinone. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
3-(4-chlorophenyl)-2,3-dihydroisoindol-1-one (CAS 2224-77-3) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 3-(4-chlorophenyl)-2,3-dihydroisoindol-1-one. InChIKey: OMUHBVDRMKRVLW-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2,3-dihydroisoindol-1-one |
| InChIKey | OMUHBVDRMKRVLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(NC2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)