Products 2225126-98-5

CAS 2225126-98-5 is the registry number for 2-((3S)-Pyrrolidin-3-yloxy)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(3S)-pyrrolidin-3-yl]oxyacetic acid;hydrochloride (CAS 2225126-98-5) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: 2-[(3S)-pyrrolidin-3-yl]oxyacetic acid;hydrochloride. InChIKey: HVMFNAFAIQPXAA-JEDNCBNOSA-N.

Identity
Molecular formulaC6H12ClNO3
Molecular weight181.62 g/mol
IUPAC name2-[(3S)-pyrrolidin-3-yl]oxyacetic acid;hydrochloride
InChIKeyHVMFNAFAIQPXAA-JEDNCBNOSA-N
SMILESC1CNC[C@H]1OCC(=O)O.Cl

Computed by PubChem (NCBI)