CAS 2225127-08-0 is the registry number for (3aR)-Hexahydro-1λâ¶-pyrrolo(1,2-b)(1,2,5)thiadiazole-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aR)-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-3-one (CAS 2225127-08-0) is a chemical compound with the molecular formula C5H8N2O3S and a molecular weight of 176.20 g/mol. IUPAC name: (3aR)-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-3-one. InChIKey: AMZLQADVZUGEDR-SCSAIBSYSA-N.
| Molecular formula | C5H8N2O3S |
|---|---|
| Molecular weight | 176.20 g/mol |
| IUPAC name | (3aR)-1,1-dioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-3-one |
| InChIKey | AMZLQADVZUGEDR-SCSAIBSYSA-N |
| SMILES | C1C[C@@H]2C(=O)NS(=O)(=O)N2C1 |
Computed by PubChem (NCBI)