Products 2225136-50-3
CAS 2225136-50-3 is the registry number for 1-(4-tert-Butylphenyl)-6-oxo-1,4,5,6-tetrahydropyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(4-tert-butylphenyl)-6-oxo-4,5-dihydropyridazine-3-carboxylic acid (CAS 2225136-50-3) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-6-oxo-4,5-dihydropyridazine-3-carboxylic acid. InChIKey: HRENCGZBSMDVSJ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
| InChIKey | HRENCGZBSMDVSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N2C(=O)CCC(=N2)C(=O)O |
Computed by PubChem (NCBI)