Products 2225136-95-6
CAS 2225136-95-6 is the registry number for 2-Hydroxy-5,6,7,8-tetrahydro-1,8-naphthyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-oxo-5,6,7,8-tetrahydro-1H-1,8-naphthyridine-4-carboxylic acid (CAS 2225136-95-6) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 2-oxo-5,6,7,8-tetrahydro-1H-1,8-naphthyridine-4-carboxylic acid. InChIKey: FFSVSEGXPNZITR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 2-oxo-5,6,7,8-tetrahydro-1H-1,8-naphthyridine-4-carboxylic acid |
| InChIKey | FFSVSEGXPNZITR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(NC1)NC(=O)C=C2C(=O)O |
Computed by PubChem (NCBI)