Products 2225141-32-0

CAS 2225141-32-0 is the registry number for 1,4-Di-tert-butyl 4-(prop-2-yn-1-yl)piperidine-1,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ditert-butyl 4-prop-2-ynylpiperidine-1,4-dicarboxylate (CAS 2225141-32-0) is a chemical compound with the molecular formula C18H29NO4 and a molecular weight of 323.4 g/mol. IUPAC name: ditert-butyl 4-prop-2-ynylpiperidine-1,4-dicarboxylate. InChIKey: KCMGSZLKKRVNKG-UHFFFAOYSA-N.

Identity
Molecular formulaC18H29NO4
Molecular weight323.4 g/mol
IUPAC nameditert-butyl 4-prop-2-ynylpiperidine-1,4-dicarboxylate
InChIKeyKCMGSZLKKRVNKG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CC#C

Computed by PubChem (NCBI)