Products 2225147-36-2
CAS 2225147-36-2 is the registry number for tert-Butyl N-(3-amino-1-methylcyclobutyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-(3-amino-1-methylcyclobutyl)carbamate;hydrochloride (CAS 2225147-36-2) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-(3-amino-1-methylcyclobutyl)carbamate;hydrochloride. InChIKey: HGTCPVXJOIWWRU-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-(3-amino-1-methylcyclobutyl)carbamate;hydrochloride |
| InChIKey | HGTCPVXJOIWWRU-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)N)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)