CAS 2225155-70-2 is the registry number for 2–(n–Propyl–d7)–4–chloropyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-chloro-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidin-5-yl]boronic acid (CAS 2225155-70-2) is a chemical compound with the molecular formula C7H10BClN2O2 and a molecular weight of 207.47 g/mol. IUPAC name: [4-chloro-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidin-5-yl]boronic acid. InChIKey: INORNGFEUGYUBS-NCKGIQLSSA-N.
| Molecular formula | C7H10BClN2O2 |
|---|---|
| Molecular weight | 207.47 g/mol |
| IUPAC name | [4-chloro-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidin-5-yl]boronic acid |
| InChIKey | INORNGFEUGYUBS-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC=C(C(=N1)Cl)B(O)O |
Computed by PubChem (NCBI)