CAS 2225178-46-9 is the registry number for 2–Chloro–4–(n–propyl–d7)–pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidin-5-yl]boronic acid (CAS 2225178-46-9) is a chemical compound with the molecular formula C7H10BClN2O2 and a molecular weight of 207.47 g/mol. IUPAC name: [2-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidin-5-yl]boronic acid. InChIKey: KXUBMJLAQSKSJL-NCKGIQLSSA-N.
| Molecular formula | C7H10BClN2O2 |
|---|---|
| Molecular weight | 207.47 g/mol |
| IUPAC name | [2-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidin-5-yl]boronic acid |
| InChIKey | KXUBMJLAQSKSJL-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC(=NC=C1B(O)O)Cl |
Computed by PubChem (NCBI)