CAS 2225180-56-1 is the registry number for 2–Chloro–4–(iso–propyl)pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-chloro-4-propan-2-ylpyrimidin-5-yl)boronic acid (CAS 2225180-56-1) is a chemical compound with the molecular formula C7H10BClN2O2 and a molecular weight of 200.43 g/mol. IUPAC name: (2-chloro-4-propan-2-ylpyrimidin-5-yl)boronic acid. InChIKey: BCUUEHRKVLGZIK-UHFFFAOYSA-N.
| Molecular formula | C7H10BClN2O2 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (2-chloro-4-propan-2-ylpyrimidin-5-yl)boronic acid |
| InChIKey | BCUUEHRKVLGZIK-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1C(C)C)Cl)(O)O |
Computed by PubChem (NCBI)