Products 2225155-86-0
CAS 2225155-86-0 is the registry number for 2–(Diethylamino)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-(diethylamino)-4-pyridinyl]boronic acid (CAS 2225155-86-0) is a chemical compound with the molecular formula C9H15BN2O2 and a molecular weight of 194.04 g/mol. IUPAC name: [2-(diethylamino)-4-pyridinyl]boronic acid. InChIKey: XSAYEXXOJSWZCL-UHFFFAOYSA-N.
| Molecular formula | C9H15BN2O2 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | [2-(diethylamino)-4-pyridinyl]boronic acid |
| InChIKey | XSAYEXXOJSWZCL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)N(CC)CC)(O)O |
Computed by PubChem (NCBI)