Products 2225180-08-3
CAS 2225180-08-3 is the registry number for 2–(Diethylamino–d10)–pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]-4-pyridinyl]boronic acid (CAS 2225180-08-3) is a chemical compound with the molecular formula C9H15BN2O2 and a molecular weight of 204.10 g/mol. IUPAC name: [2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]-4-pyridinyl]boronic acid. InChIKey: XSAYEXXOJSWZCL-MWUKXHIBSA-N.
| Molecular formula | C9H15BN2O2 |
|---|---|
| Molecular weight | 204.10 g/mol |
| IUPAC name | [2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]-4-pyridinyl]boronic acid |
| InChIKey | XSAYEXXOJSWZCL-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C1=NC=CC(=C1)B(O)O)C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)