Products 2803541-36-6
CAS 2803541-36-6 is the registry number for (3-Cyclopropyl-1-isopropyl-1H-pyrazol-4-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-cyclopropyl-1-propan-2-ylpyrazol-4-yl)boronic acid (CAS 2803541-36-6) is a chemical compound with the molecular formula C9H15BN2O2 and a molecular weight of 194.04 g/mol. IUPAC name: (3-cyclopropyl-1-propan-2-ylpyrazol-4-yl)boronic acid. InChIKey: VOQNGVKFRVLDMO-UHFFFAOYSA-N.
| Molecular formula | C9H15BN2O2 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (3-cyclopropyl-1-propan-2-ylpyrazol-4-yl)boronic acid |
| InChIKey | VOQNGVKFRVLDMO-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C2CC2)C(C)C)(O)O |
Computed by PubChem (NCBI)