Products 2225169-47-9
CAS 2225169-47-9 is the registry number for 3–(Piperidin–4–yl)–5–(tert–butyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(3-tert-butyl-5-piperidin-4-ylphenyl)boronic acid (CAS 2225169-47-9) is a chemical compound with the molecular formula C15H24BNO2 and a molecular weight of 261.17 g/mol. IUPAC name: (3-tert-butyl-5-piperidin-4-ylphenyl)boronic acid. InChIKey: CKKWITDEUKMBST-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2 |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | (3-tert-butyl-5-piperidin-4-ylphenyl)boronic acid |
| InChIKey | CKKWITDEUKMBST-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C2CCNCC2)(O)O |
Computed by PubChem (NCBI)