CAS 2225169-85-5 is the registry number for 2–(2–HYDROXYPROPAN–2–YL–d6)–PYRIDINE–4–BORONIC ACID. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-4-pyridinyl]boronic acid (CAS 2225169-85-5) is a chemical compound with the molecular formula C8H12BNO3 and a molecular weight of 187.04 g/mol. IUPAC name: [2-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-4-pyridinyl]boronic acid. InChIKey: KNTNQMJSIOKMSF-WFGJKAKNSA-N.
| Molecular formula | C8H12BNO3 |
|---|---|
| Molecular weight | 187.04 g/mol |
| IUPAC name | [2-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-4-pyridinyl]boronic acid |
| InChIKey | KNTNQMJSIOKMSF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=NC=CC(=C1)B(O)O)(C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)