CAS 2225170-57-8 is the registry number for 2–(iso–Butyl–d9)–pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]pyrimidin-5-yl]boronic acid (CAS 2225170-57-8) is a chemical compound with the molecular formula C8H13BN2O2 and a molecular weight of 189.07 g/mol. IUPAC name: [2-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]pyrimidin-5-yl]boronic acid. InChIKey: RXXIHRKWXOKSGS-GMFBVPFISA-N.
| Molecular formula | C8H13BN2O2 |
|---|---|
| Molecular weight | 189.07 g/mol |
| IUPAC name | [2-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]pyrimidin-5-yl]boronic acid |
| InChIKey | RXXIHRKWXOKSGS-GMFBVPFISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C1=NC=C(C=N1)B(O)O |
Computed by PubChem (NCBI)