Products 2225171-95-7
CAS 2225171-95-7 is the registry number for 5–(Piperidin–4–yl)–2–trifluoromethylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[5-piperidin-4-yl-2-(trifluoromethyl)phenyl]boronic acid (CAS 2225171-95-7) is a chemical compound with the molecular formula C12H15BF3NO2 and a molecular weight of 273.06 g/mol. IUPAC name: [5-piperidin-4-yl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: WWTHYPFQPCOTIR-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO2 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | [5-piperidin-4-yl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WWTHYPFQPCOTIR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2CCNCC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)