Products 2225172-09-6
CAS 2225172-09-6 is the registry number for 2–Cyclopropyl–5–(pyrrolidino)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(2-cyclopropyl-5-pyrrolidin-1-ylphenyl)boronic acid (CAS 2225172-09-6) is a chemical compound with the molecular formula C13H18BNO2 and a molecular weight of 231.10 g/mol. IUPAC name: (2-cyclopropyl-5-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: BLVSLEPNLOIKCM-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO2 |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | (2-cyclopropyl-5-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | BLVSLEPNLOIKCM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)N2CCCC2)C3CC3)(O)O |
Computed by PubChem (NCBI)