CAS 2374706-89-3 is the registry number for 3-(1-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)vinyl)pyridine, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g.
3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (CAS 2374706-89-3) is a chemical compound with the molecular formula C13H18BNO2 and a molecular weight of 231.10 g/mol. IUPAC name: 3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine. InChIKey: YEMFGPXLAKEBOD-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO2 |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| InChIKey | YEMFGPXLAKEBOD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CN=CC=C2 |
Computed by PubChem (NCBI)