Products 2762661-51-6
CAS 2762661-51-6 is the registry number for 2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2762661-51-6) is a chemical compound with the molecular formula C13H18BNO2 and a molecular weight of 231.10 g/mol. IUPAC name: 2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: PAIYBURLXVQODN-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO2 |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | PAIYBURLXVQODN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)C=C |
Computed by PubChem (NCBI)