CAS 2256708-74-2 is the registry number for (4–(1H–imidazol–1–yl)–3–(trifluoromethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[4-imidazol-1-yl-3-(trifluoromethyl)phenyl]boronic acid (CAS 2256708-74-2) is a chemical compound with the molecular formula C10H8BF3N2O2 and a molecular weight of 255.99 g/mol. IUPAC name: [4-imidazol-1-yl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: RKEZLEIHCJRCKV-UHFFFAOYSA-N.
| Molecular formula | C10H8BF3N2O2 |
|---|---|
| Molecular weight | 255.99 g/mol |
| IUPAC name | [4-imidazol-1-yl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | RKEZLEIHCJRCKV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2C=CN=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)