CAS 2225181-13-3 is the registry number for 1–(2–Trifluoromethylphenyl)–1H–pyrazole–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[1-[2-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid (CAS 2225181-13-3) is a chemical compound with the molecular formula C10H8BF3N2O2 and a molecular weight of 255.99 g/mol. IUPAC name: [1-[2-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid. InChIKey: ASHGSWUZOFBLHI-UHFFFAOYSA-N.
| Molecular formula | C10H8BF3N2O2 |
|---|---|
| Molecular weight | 255.99 g/mol |
| IUPAC name | [1-[2-(trifluoromethyl)phenyl]pyrazol-4-yl]boronic acid |
| InChIKey | ASHGSWUZOFBLHI-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC=CC=C2C(F)(F)F)(O)O |
Computed by PubChem (NCBI)