Products 2225179-47-3
CAS 2225179-47-3 is the registry number for 2–Chloro–3–cyclopropyl–5–cyanophenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-chloro-5-cyano-3-cyclopropylphenyl)boronic acid (CAS 2225179-47-3) is a chemical compound with the molecular formula C10H9BClNO2 and a molecular weight of 221.45 g/mol. IUPAC name: (2-chloro-5-cyano-3-cyclopropylphenyl)boronic acid. InChIKey: DORCHIACRSDIJE-UHFFFAOYSA-N.
| Molecular formula | C10H9BClNO2 |
|---|---|
| Molecular weight | 221.45 g/mol |
| IUPAC name | (2-chloro-5-cyano-3-cyclopropylphenyl)boronic acid |
| InChIKey | DORCHIACRSDIJE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Cl)C2CC2)C#N)(O)O |
Computed by PubChem (NCBI)