Products 2377609-59-9
CAS 2377609-59-9 appears in our catalog under these names: [2-Chloro-4-(1-cyanocyclopropyl)phenyl]boronic acid, 95%, [2-Chloro-4-(1-cyanocyclopropyl)phenyl]boronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
[2-chloro-4-(1-cyanocyclopropyl)phenyl]boronic acid (CAS 2377609-59-9) is a chemical compound with the molecular formula C10H9BClNO2 and a molecular weight of 221.45 g/mol. IUPAC name: [2-chloro-4-(1-cyanocyclopropyl)phenyl]boronic acid. InChIKey: PYFAFKSHWLMVHN-UHFFFAOYSA-N.
| Molecular formula | C10H9BClNO2 |
|---|---|
| Molecular weight | 221.45 g/mol |
| IUPAC name | [2-chloro-4-(1-cyanocyclopropyl)phenyl]boronic acid |
| InChIKey | PYFAFKSHWLMVHN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2(CC2)C#N)Cl)(O)O |
Computed by PubChem (NCBI)