Products 2377605-68-8
CAS 2377605-68-8 is the registry number for (7-Chloro-8-methylquinolin-6-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(7-chloro-8-methylquinolin-6-yl)boronic acid (CAS 2377605-68-8) is a chemical compound with the molecular formula C10H9BClNO2 and a molecular weight of 221.45 g/mol. IUPAC name: (7-chloro-8-methylquinolin-6-yl)boronic acid. InChIKey: RDJIHCAVLJQCFP-UHFFFAOYSA-N.
| Molecular formula | C10H9BClNO2 |
|---|---|
| Molecular weight | 221.45 g/mol |
| IUPAC name | (7-chloro-8-methylquinolin-6-yl)boronic acid |
| InChIKey | RDJIHCAVLJQCFP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C(=C1Cl)C)N=CC=C2)(O)O |
Computed by PubChem (NCBI)