Products 2227198-41-4
CAS 2227198-41-4 is the registry number for Methyl (1S,3R)-3-((tert-butoxycarbonyl)amino)-5-oxocyclohexane-1-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Cis-methyl (1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxocyclohexane-1-carboxylate (CAS 2227198-41-4) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: cis-methyl (1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxocyclohexane-1-carboxylate. InChIKey: ZPTMKWXDNOBVGK-DTWKUNHWSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxocyclohexane-1-carboxylate |
| InChIKey | ZPTMKWXDNOBVGK-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](CC(=O)C1)C(=O)OC |
Computed by PubChem (NCBI)