Products 2227202-47-1
CAS 2227202-47-1 is the registry number for (1S,4R)-2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.2.2]octane-5-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(1S,4R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.2]octane-5-carboxylic acid (CAS 2227202-47-1) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (1S,4R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.2]octane-5-carboxylic acid. InChIKey: VOLSDHFHZGQKBS-XMCUXHSSSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (1S,4R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.2]octane-5-carboxylic acid |
| InChIKey | VOLSDHFHZGQKBS-XMCUXHSSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@H]1CC2C(=O)O |
Computed by PubChem (NCBI)