Products 2227205-08-3
CAS 2227205-08-3 is the registry number for 2H-Pyrrolo[2,3-c]pyridin-2-one, 7-bromo-1,3-dihydro-3,3-dimethyl-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
7-bromo-3,3-dimethyl-1H-pyrrolo[2,3-c]pyridin-2-one (CAS 2227205-08-3) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-3,3-dimethyl-1H-pyrrolo[2,3-c]pyridin-2-one. InChIKey: JIAKQXSLRHHLMQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-3,3-dimethyl-1H-pyrrolo[2,3-c]pyridin-2-one |
| InChIKey | JIAKQXSLRHHLMQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=NC=C2)Br)NC1=O)C |
Computed by PubChem (NCBI)