CAS 2227662-58-8 appears in our catalog under these names: trans–2–(2–isopropylphenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-[2-(propan-2-yl)phenyl]cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 5g.
Trans-(1R,2R)-2-(2-propan-2-ylphenyl)cyclopropane-1-carboxylic acid (CAS 2227662-58-8) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: trans-(1R,2R)-2-(2-propan-2-ylphenyl)cyclopropane-1-carboxylic acid. InChIKey: KLJKMWBGBRSSSP-NWDGAFQWSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | trans-(1R,2R)-2-(2-propan-2-ylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | KLJKMWBGBRSSSP-NWDGAFQWSA-N |
| SMILES | CC(C)C1=CC=CC=C1[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)