Products 2228153-34-0

CAS 2228153-34-0 is the registry number for 4-(Methoxycarbonyl)-1-benzothiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-methoxycarbonyl-1-benzothiophene-2-carboxylic acid (CAS 2228153-34-0) is a chemical compound with the molecular formula C11H8O4S and a molecular weight of 236.25 g/mol. IUPAC name: 4-methoxycarbonyl-1-benzothiophene-2-carboxylic acid. InChIKey: UZMZJQNQJIGNEV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O4S
Molecular weight236.25 g/mol
IUPAC name4-methoxycarbonyl-1-benzothiophene-2-carboxylic acid
InChIKeyUZMZJQNQJIGNEV-UHFFFAOYSA-N
SMILESCOC(=O)C1=C2C=C(SC2=CC=C1)C(=O)O

Computed by PubChem (NCBI)