CAS 255828-29-6 is the registry number for Methyl 3-(5-Formyl-2-furyl)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g.
Methyl 3-(5-formylfuran-2-yl)thiophene-2-carboxylate (CAS 255828-29-6) is a chemical compound with the molecular formula C11H8O4S and a molecular weight of 236.25 g/mol. IUPAC name: methyl 3-(5-formylfuran-2-yl)thiophene-2-carboxylate. InChIKey: RZYUUAQLLIBFPT-UHFFFAOYSA-N.
| Molecular formula | C11H8O4S |
|---|---|
| Molecular weight | 236.25 g/mol |
| IUPAC name | methyl 3-(5-formylfuran-2-yl)thiophene-2-carboxylate |
| InChIKey | RZYUUAQLLIBFPT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)