Products 330801-81-5

CAS 330801-81-5 is the registry number for 2-(Methoxycarbonyl)benzo[b]thiophene-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methoxycarbonyl-1-benzothiophene-6-carboxylic acid (CAS 330801-81-5) is a chemical compound with the molecular formula C11H8O4S and a molecular weight of 236.25 g/mol. IUPAC name: 2-methoxycarbonyl-1-benzothiophene-6-carboxylic acid. InChIKey: FHVOLLCTQYCWTO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O4S
Molecular weight236.25 g/mol
IUPAC name2-methoxycarbonyl-1-benzothiophene-6-carboxylic acid
InChIKeyFHVOLLCTQYCWTO-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(S1)C=C(C=C2)C(=O)O

Computed by PubChem (NCBI)