Products 2228264-91-1
CAS 2228264-91-1 is the registry number for 1'-{((tert-Butoxy)carbonyl)amino}-(1,1'-bi(cyclobutane))-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]cyclobutane-1-carboxylic acid (CAS 2228264-91-1) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]cyclobutane-1-carboxylic acid. InChIKey: IEPGVSBXIYMYLG-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]cyclobutane-1-carboxylic acid |
| InChIKey | IEPGVSBXIYMYLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC1)C2(CCC2)C(=O)O |
Computed by PubChem (NCBI)