CAS 2228648-69-7 appears in our catalog under these names: 5-Amino-2,2-difluorospiro(2.3)hexane-1-carboxylic acid hydrochloride, 98%, 5-Amino-2,2-difluorospiro(2.3)hexane-1-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-amino-2,2-difluorospiro[2.3]hexane-1-carboxylic acid;hydrochloride (CAS 2228648-69-7) is a chemical compound with the molecular formula C7H10ClF2NO2 and a molecular weight of 213.61 g/mol. IUPAC name: 5-amino-2,2-difluorospiro[2.3]hexane-1-carboxylic acid;hydrochloride. InChIKey: GXIAOBPJRRMVSE-UHFFFAOYSA-N.
| Molecular formula | C7H10ClF2NO2 |
|---|---|
| Molecular weight | 213.61 g/mol |
| IUPAC name | 5-amino-2,2-difluorospiro[2.3]hexane-1-carboxylic acid;hydrochloride |
| InChIKey | GXIAOBPJRRMVSE-UHFFFAOYSA-N |
| SMILES | C1C(CC12C(C2(F)F)C(=O)O)N.Cl |
Computed by PubChem (NCBI)