CAS 478258-79-6 is the registry number for 2-Chloro-2,2-difluoro-1-(4-hydroxypiperidin-1-yl)ethanone, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-chloro-2,2-difluoro-1-(4-hydroxypiperidin-1-yl)ethanone (CAS 478258-79-6) is a chemical compound with the molecular formula C7H10ClF2NO2 and a molecular weight of 213.61 g/mol. IUPAC name: 2-chloro-2,2-difluoro-1-(4-hydroxypiperidin-1-yl)ethanone. InChIKey: JFEUMTDKMNZFLA-UHFFFAOYSA-N.
| Molecular formula | C7H10ClF2NO2 |
|---|---|
| Molecular weight | 213.61 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-1-(4-hydroxypiperidin-1-yl)ethanone |
| InChIKey | JFEUMTDKMNZFLA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)C(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)