CAS 2639440-40-5 is the registry number for 4-(Difluoromethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(difluoromethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid;hydrochloride (CAS 2639440-40-5) is a chemical compound with the molecular formula C7H10ClF2NO2 and a molecular weight of 213.61 g/mol. IUPAC name: 4-(difluoromethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid;hydrochloride. InChIKey: ODMQMUHHOHWTIK-UHFFFAOYSA-N.
| Molecular formula | C7H10ClF2NO2 |
|---|---|
| Molecular weight | 213.61 g/mol |
| IUPAC name | 4-(difluoromethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid;hydrochloride |
| InChIKey | ODMQMUHHOHWTIK-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(NC2)C(=O)O)C(F)F.Cl |
Computed by PubChem (NCBI)