Products 2228993-53-9
CAS 2228993-53-9 appears in our catalog under these names: 3–(1，1–difluoro–2–hydroxyethyl)benzonitrile, 3-(1，1-difluoro-2-hydroxyethyl)benzonitrile. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 200mg, 5g.
3-(1,1-difluoro-2-hydroxyethyl)benzonitrile (CAS 2228993-53-9) is a chemical compound with the molecular formula C9H7F2NO and a molecular weight of 183.15 g/mol. IUPAC name: 3-(1,1-difluoro-2-hydroxyethyl)benzonitrile. InChIKey: GMPGCKZFJKZIDO-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | 3-(1,1-difluoro-2-hydroxyethyl)benzonitrile |
| InChIKey | GMPGCKZFJKZIDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(CO)(F)F)C#N |
Computed by PubChem (NCBI)