CAS 2229153-34-6 is the registry number for α-Ethenyl-3-(1-methylethyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-propan-2-ylphenyl)prop-2-en-1-ol (CAS 2229153-34-6) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 1-(3-propan-2-ylphenyl)prop-2-en-1-ol. InChIKey: MQNGNBGGOIVTKP-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1-(3-propan-2-ylphenyl)prop-2-en-1-ol |
| InChIKey | MQNGNBGGOIVTKP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)C(C=C)O |
Computed by PubChem (NCBI)