Products 2229726-07-0
CAS 2229726-07-0 is the registry number for 1-(1,1-Dimethylethyl) 4-(4-carboxy-3-formylphenyl)-1-piperazinecarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-formyl-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid (CAS 2229726-07-0) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: 2-formyl-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid. InChIKey: GELZPNPRRUOMMG-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-formyl-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid |
| InChIKey | GELZPNPRRUOMMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=C(C=C2)C(=O)O)C=O |
Computed by PubChem (NCBI)