Products 2229959-74-2
CAS 2229959-74-2 is the registry number for 3-Morpholin-4-yl-bicyclo[1.1.1]pentane-1-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-morpholin-4-ylbicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2229959-74-2) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: 3-morpholin-4-ylbicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: NDGKAVBODCAAEV-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 3-morpholin-4-ylbicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | NDGKAVBODCAAEV-UHFFFAOYSA-N |
| SMILES | C1COCCN1C23CC(C2)(C3)C(=O)O |
Computed by PubChem (NCBI)