CAS 2229976-12-7 is the registry number for (E)-3-(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)acrylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(E)-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]prop-2-enoic acid (CAS 2229976-12-7) is a chemical compound with the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. IUPAC name: (E)-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]prop-2-enoic acid. InChIKey: FXBREOSVRBJEDR-QHHAFSJGSA-N.
| Molecular formula | C16H12N2O6 |
|---|---|
| Molecular weight | 328.28 g/mol |
| IUPAC name | (E)-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]prop-2-enoic acid |
| InChIKey | FXBREOSVRBJEDR-QHHAFSJGSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)/C=C/C(=O)O |
Computed by PubChem (NCBI)